![Octahydro-pyrrolo[1,2-a]pyrazine (CAS: 5654-83-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0676643.png "Octahydro-pyrrolo[1,2-a]pyrazine chemical structure")
Octahydro-pyrrolo[1,2-a]pyrazine
Catalog No: FT-0676643
CAS No: 5654-83-1
- Chemical Name: Octahydro-pyrrolo[1,2-a]pyrazine
- Molecular Formula: C7H14N2
- Molecular Weight: 126.20
- InChI Key: FTTATHOUSOIFOQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H14N2/c1-2-7-6-8-3-5-9(7)4-1/h7-8H,1-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1,4-Diazabicyclo[4.3.0]nonane |
|---|---|
| Flash_Point: | 88.8±9.4 °C |
| Melting_Point: | N/A |
| FW: | 126.200 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 5654-83-1 |
| Bolling_Point: | 199.6±8.0 °C at 760 mmHg |
| MF: | C7H14N2 |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | 0.44 |
| Flash_Point: | 88.8±9.4 °C |
| Refractive_Index: | 1.534 |
| FW: | 126.200 |
| PSA: | 15.27000 |
| MF: | C7H14N2 |
| Bolling_Point: | 199.6±8.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.3±0.4 mmHg at 25°C |
| Exact_Mass: | 126.115700 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933990090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)